C32H37N7O5 — CID 156743329
benzyl N-[2-[3-[5-amino-6-[(4-morpholin-4-yl-3-pyridinyl)carbamoyl]pyrazin-2-yl]phenoxy]ethyl]carbamate;ethane (PubChem CID 156743329) has the molecular formula C32H37N7O5 and a molecular weight of 599.69 g/mol. Its IUPAC name is benzyl N-[2-[3-[5-amino-6-[(4-morpholin-4-yl-3-pyridinyl)carbamoyl]pyrazin-2-yl]phenoxy]ethyl]carbamate;ethane.
| Compound Name | benzyl N-[2-[3-[5-amino-6-[(4-morpholin-4-yl-3-pyridinyl)carbamoyl]pyrazin-2-yl]phenoxy]ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 156743329 |
| Molecular Formula | C32H37N7O5 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | benzyl N-[2-[3-[5-amino-6-[(4-morpholin-4-yl-3-pyridinyl)carbamoyl]pyrazin-2-yl]phenoxy]ethyl]carbamate;ethane |
| SMILES | CC.Nc1ncc(-c2cccc(OCCNC(=O)OCc3ccccc3)c2)nc1C(=O)Nc1cnccc1N1CCOCC1 |
| InChI | InChI=1S/C30H31N7O5.C2H6/c31-28-27(29(38)36-25-18-32-10-9-26(25)37-12-15-40-16-13-37)35-24(19-34-28)22-7-4-8-23(17-22)41-14-11-33-30(39)42-20-21-5-2-1-3-6-21;1-2/h1-10,17-19H,11-16,20H2,(H2,31,34)(H,33,39)(H,36,38);1-2H3 |
| InChIKey | OMTRWBWCZUSNQF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 153.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|