C21H21N5O2 — CID 167691905
1-(3-amino-6-phenylpyrazin-2-yl)-2-(4-morpholin-4-yl-3-pyridinyl)ethanone (PubChem CID 167691905) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(3-amino-6-phenylpyrazin-2-yl)-2-(4-morpholin-4-yl-3-pyridinyl)ethanone.
| Compound Name | 1-(3-amino-6-phenylpyrazin-2-yl)-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 167691905 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-(3-amino-6-phenylpyrazin-2-yl)-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
| SMILES | Nc1ncc(-c2ccccc2)nc1C(=O)Cc1cnccc1N1CCOCC1 |
| InChI | InChI=1S/C21H21N5O2/c22-21-20(25-17(14-24-21)15-4-2-1-3-5-15)19(27)12-16-13-23-7-6-18(16)26-8-10-28-11-9-26/h1-7,13-14H,8-12H2,(H2,22,24) |
| InChIKey | XBOWAAKLCMWPLY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |