C21H20ClN5O2 — CID 167618356
1-[3-amino-6-(3-chlorophenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone (PubChem CID 167618356) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 1-[3-amino-6-(3-chlorophenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone.
| Compound Name | 1-[3-amino-6-(3-chlorophenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 167618356 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[3-amino-6-(3-chlorophenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
| SMILES | Nc1ncc(-c2cccc(Cl)c2)nc1C(=O)Cc1cnccc1N1CCOCC1 |
| InChI | InChI=1S/C21H20ClN5O2/c22-16-3-1-2-14(10-16)17-13-25-21(23)20(26-17)19(28)11-15-12-24-5-4-18(15)27-6-8-29-9-7-27/h1-5,10,12-13H,6-9,11H2,(H2,23,25) |
| InChIKey | MBOGTMZJXMUFBE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |