C25H29N5O2 — CID 167680699
1-[3-amino-6-(3-butylphenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone (PubChem CID 167680699) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[3-amino-6-(3-butylphenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone.
| Compound Name | 1-[3-amino-6-(3-butylphenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 167680699 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-[3-amino-6-(3-butylphenyl)pyrazin-2-yl]-2-(4-morpholin-4-yl-3-pyridinyl)ethanone |
| SMILES | CCCCc1cccc(-c2cnc(N)c(C(=O)Cc3cnccc3N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C25H29N5O2/c1-2-3-5-18-6-4-7-19(14-18)21-17-28-25(26)24(29-21)23(31)15-20-16-27-9-8-22(20)30-10-12-32-13-11-30/h4,6-9,14,16-17H,2-3,5,10-13,15H2,1H3,(H2,26,28) |
| InChIKey | VMPAEAZMLLUFEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |