C29H27ClN6O2 — CID 142494282
7-(1-benzylpyrazol-4-yl)-6-chloro-1-methyl-3-(4-morpholin-4-ylanilino)quinoxalin-2-one (PubChem CID 142494282) has the molecular formula C29H27ClN6O2 and a molecular weight of 527.03 g/mol. Its IUPAC name is 7-(1-benzylpyrazol-4-yl)-6-chloro-1-methyl-3-(4-morpholin-4-ylanilino)quinoxalin-2-one.
| Compound Name | 7-(1-benzylpyrazol-4-yl)-6-chloro-1-methyl-3-(4-morpholin-4-ylanilino)quinoxalin-2-one |
|---|---|
| PubChem CID | 142494282 |
| Molecular Formula | C29H27ClN6O2 |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 7-(1-benzylpyrazol-4-yl)-6-chloro-1-methyl-3-(4-morpholin-4-ylanilino)quinoxalin-2-one |
| SMILES | Cn1c(=O)c(Nc2ccc(N3CCOCC3)cc2)nc2cc(Cl)c(-c3cnn(Cc4ccccc4)c3)cc21 |
| InChI | InChI=1S/C29H27ClN6O2/c1-34-27-15-24(21-17-31-36(19-21)18-20-5-3-2-4-6-20)25(30)16-26(27)33-28(29(34)37)32-22-7-9-23(10-8-22)35-11-13-38-14-12-35/h2-10,15-17,19H,11-14,18H2,1H3,(H,32,33) |
| InChIKey | VIBZLUVCIGMJFN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|