C22H23N7O2 — CID 146479484
7-(2-amino-1H-imidazol-5-yl)-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one (PubChem CID 146479484) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 7-(2-amino-1H-imidazol-5-yl)-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one.
| Compound Name | 7-(2-amino-1H-imidazol-5-yl)-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one |
|---|---|
| PubChem CID | 146479484 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 7-(2-amino-1H-imidazol-5-yl)-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one |
| SMILES | Cn1c(=O)c(Nc2ccccc2N2CCOCC2)nc2ccc(-c3cnc(N)[nH]3)cc21 |
| InChI | InChI=1S/C22H23N7O2/c1-28-19-12-14(17-13-24-22(23)27-17)6-7-16(19)26-20(21(28)30)25-15-4-2-3-5-18(15)29-8-10-31-11-9-29/h2-7,12-13H,8-11H2,1H3,(H,25,26)(H3,23,24,27) |
| InChIKey | LVSDHRFXLCAESZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|