C25H23N7O2 — CID 146479528
7-imidazo[1,2-a]pyrimidin-3-yl-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one (PubChem CID 146479528) has the molecular formula C25H23N7O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is 7-imidazo[1,2-a]pyrimidin-3-yl-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one.
| Compound Name | 7-imidazo[1,2-a]pyrimidin-3-yl-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one |
|---|---|
| PubChem CID | 146479528 |
| Molecular Formula | C25H23N7O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 7-imidazo[1,2-a]pyrimidin-3-yl-1-methyl-3-(2-morpholin-4-ylanilino)quinoxalin-2-one |
| SMILES | Cn1c(=O)c(Nc2ccccc2N2CCOCC2)nc2ccc(-c3cnc4ncccn34)cc21 |
| InChI | InChI=1S/C25H23N7O2/c1-30-21-15-17(22-16-27-25-26-9-4-10-32(22)25)7-8-19(21)29-23(24(30)33)28-18-5-2-3-6-20(18)31-11-13-34-14-12-31/h2-10,15-16H,11-14H2,1H3,(H,28,29) |
| InChIKey | BDWVYFCFVWVJLM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|