7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid

C12H11N3O2 — CID 142496402

IUPAC7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc(N3CCC3)ncc2c1
InChIInChI=1S/C12H11N3O2/c16-12(17)9-4-8-6-14-11(15-2-1-3-15)5-10(8)13-7-9/h4-7H,1-3H2,(H,16,17)
InChIKeyMVKWOKMWCFNNON-UHFFFAOYSA-N
MW229.24 g/mol
LogP1.54
Rot. Bonds2

About 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid

7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid (PubChem CID 142496402) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid
PubChem CID142496402
Molecular FormulaC12H11N3O2
Molecular Weight229.24 g/mol
Exact Mass229.09
IUPAC Name7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc(N3CCC3)ncc2c1
InChIInChI=1S/C12H11N3O2/c16-12(17)9-4-8-6-14-11(15-2-1-3-15)5-10(8)13-7-9/h4-7H,1-3H2,(H,16,17)
InChIKeyMVKWOKMWCFNNON-UHFFFAOYSA-N
XLogP1.54
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.24
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid?
The IUPAC name of 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid (CID 142496402) is 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid?
The canonical SMILES for 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid is O=C(O)c1cnc2cc(N3CCC3)ncc2c1.
What is the InChIKey of 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid?
The InChIKey is MVKWOKMWCFNNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-12(17)9-4-8-6-14-11(15-2-1-3-15)5-10(8)13-7-9/h4-7H,1-3H2,(H,16,17).
What are the key properties of 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid?
7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid has a molecular weight of 229.24 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(azetidin-1-yl)-1,6-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 142496402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).