C23H26O5 — CID 142496966
methyl 2-(cyclohexanecarbonyl)-5-methoxy-4-phenylmethoxybenzoate (PubChem CID 142496966) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 2-(cyclohexanecarbonyl)-5-methoxy-4-phenylmethoxybenzoate.
| Compound Name | methyl 2-(cyclohexanecarbonyl)-5-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 142496966 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl 2-(cyclohexanecarbonyl)-5-methoxy-4-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OCc2ccccc2)cc1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H26O5/c1-26-20-14-19(23(25)27-2)18(22(24)17-11-7-4-8-12-17)13-21(20)28-15-16-9-5-3-6-10-16/h3,5-6,9-10,13-14,17H,4,7-8,11-12,15H2,1-2H3 |
| InChIKey | FTSQYYOMLCZHCY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |