C17H21NO5 — CID 142499891
ethyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-benzofuran-2-carboxylate (PubChem CID 142499891) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 142499891 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(NC(=O)OC(C)(C)C)c(C)ccc2o1 |
| InChI | InChI=1S/C17H21NO5/c1-6-21-15(19)13-9-11-12(22-13)8-7-10(2)14(11)18-16(20)23-17(3,4)5/h7-9H,6H2,1-5H3,(H,18,20) |
| InChIKey | MCJGAVUILKSHFZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |