C14H14Br2F3NO4S — CID 142502136
3-(3,4-dibromo-2,5,6-trifluorophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 142502136) has the molecular formula C14H14Br2F3NO4S and a molecular weight of 509.14 g/mol. Its IUPAC name is 3-(3,4-dibromo-2,5,6-trifluorophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(3,4-dibromo-2,5,6-trifluorophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 142502136 |
| Molecular Formula | C14H14Br2F3NO4S |
| Molecular Weight | 509.14 g/mol |
| Exact Mass | 506.90 |
| IUPAC Name | 3-(3,4-dibromo-2,5,6-trifluorophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CSc1c(F)c(F)c(Br)c(Br)c1F)C(=O)O |
| InChI | InChI=1S/C14H14Br2F3NO4S/c1-14(2,3)24-13(23)20-5(12(21)22)4-25-11-9(18)7(16)6(15)8(17)10(11)19/h5H,4H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | OJZRETSRUOKMFH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.14 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|