C33H41N7O2S — CID 142505242
2-[(2S,6S)-6-[4-[6-[3-acetyl-5-[(4S)-4-aminopentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]piperidin-2-yl]ethyl carbamimidothioate (PubChem CID 142505242) has the molecular formula C33H41N7O2S and a molecular weight of 599.81 g/mol. Its IUPAC name is 2-[(2S,6S)-6-[4-[6-[3-acetyl-5-[(4S)-4-aminopentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]piperidin-2-yl]ethyl carbamimidothioate.
| Compound Name | 2-[(2S,6S)-6-[4-[6-[3-acetyl-5-[(4S)-4-aminopentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]piperidin-2-yl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 142505242 |
| Molecular Formula | C33H41N7O2S |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 2-[(2S,6S)-6-[4-[6-[3-acetyl-5-[(4S)-4-aminopentyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]piperidin-2-yl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC[C@@H]1CCC[C@@H](c2ccc(-n3cc4cc(-c5cc(CCC[C@H](C)N)cc(C(C)=O)c5)[nH]c4nc3=O)cc2)N1 |
| InChI | InChI=1S/C33H41N7O2S/c1-20(34)5-3-6-22-15-24(21(2)41)17-25(16-22)30-18-26-19-40(33(42)39-31(26)38-30)28-11-9-23(10-12-28)29-8-4-7-27(37-29)13-14-43-32(35)36/h9-12,15-20,27,29,37H,3-8,13-14,34H2,1-2H3,(H3,35,36)(H,38,39,42)/t20-,27-,29-/m0/s1 |
| InChIKey | SBSNIBYYPJLEQS-UZEWVABRSA-N |
| XLogP | 5.45 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|