C8H19NO2 — CID 142505316
2,4,4,6-Tetramethylmorpholinium hydroxide (PubChem CID 142505316) has the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. Its IUPAC name is 2,4,4,6-tetramethylmorpholin-4-ium hydroxide.
| Compound Name | 2,4,4,6-Tetramethylmorpholinium hydroxide |
|---|---|
| PubChem CID | 142505316 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2,4,4,6-tetramethylmorpholin-4-ium hydroxide |
| SMILES | CC1C[N+](CC(O1)C)(C)C.[OH-] |
| InChI | InChI=1S/C8H18NO.H2O/c1-7-5-9(3,4)6-8(2)10-7;/h7-8H,5-6H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | PNWRBHNHHBXBKX-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 10.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 110 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|