C20H15Cl3N2OS — CID 142505454
6-(4-chlorophenyl)-5-[2-(3,4-dichlorophenyl)ethoxymethyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 142505454) has the molecular formula C20H15Cl3N2OS and a molecular weight of 437.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5-[2-(3,4-dichlorophenyl)ethoxymethyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(4-chlorophenyl)-5-[2-(3,4-dichlorophenyl)ethoxymethyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 142505454 |
| Molecular Formula | C20H15Cl3N2OS |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 6-(4-chlorophenyl)-5-[2-(3,4-dichlorophenyl)ethoxymethyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | Clc1ccc(-c2nc3sccn3c2COCCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H15Cl3N2OS/c21-15-4-2-14(3-5-15)19-18(25-8-10-27-20(25)24-19)12-26-9-7-13-1-6-16(22)17(23)11-13/h1-6,8,10-11H,7,9,12H2 |
| InChIKey | GSUDPDTUFUNPQG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|