C29H24N8O3 — CID 142506013
N-hydroxy-4-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]benzamide (PubChem CID 142506013) has the molecular formula C29H24N8O3 and a molecular weight of 532.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]benzamide.
| Compound Name | N-hydroxy-4-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]benzamide |
|---|---|
| PubChem CID | 142506013 |
| Molecular Formula | C29H24N8O3 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-hydroxy-4-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]benzamide |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(-c3ccc(C(=O)NO)cc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H24N8O3/c1-2-21(34-26-24-25(31-15-30-24)32-16-33-26)27-35-22-10-6-9-20(17-11-13-18(14-12-17)28(38)36-40)23(22)29(39)37(27)19-7-4-3-5-8-19/h3-16,21,40H,2H2,1H3,(H,36,38)(H2,30,31,32,33,34)/t21-/m0/s1 |
| InChIKey | NBUBHYJTHALYNG-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|