C17H23ClN2S2 — CID 142506310
N-[(5-chlorothiophen-2-yl)methyl]-1-[4-(diethylaminosulfanyl)phenyl]ethanamine (PubChem CID 142506310) has the molecular formula C17H23ClN2S2 and a molecular weight of 354.97 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-[4-(diethylaminosulfanyl)phenyl]ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-[4-(diethylaminosulfanyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 142506310 |
| Molecular Formula | C17H23ClN2S2 |
| Molecular Weight | 354.97 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-[4-(diethylaminosulfanyl)phenyl]ethanamine |
| SMILES | CCN(CC)Sc1ccc(C(C)NCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H23ClN2S2/c1-4-20(5-2)22-15-8-6-14(7-9-15)13(3)19-12-16-10-11-17(18)21-16/h6-11,13,19H,4-5,12H2,1-3H3 |
| InChIKey | XUKDTRGAKYUWNB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|