C16H20Cl2N2OS — CID 47030478
N-[4-[1-[(5-chlorothiophen-2-yl)methylamino]ethyl]phenyl]propanamide;hydrochloride (PubChem CID 47030478) has the molecular formula C16H20Cl2N2OS and a molecular weight of 359.32 g/mol. Its IUPAC name is N-[4-[1-[(5-chlorothiophen-2-yl)methylamino]ethyl]phenyl]propanamide;hydrochloride.
| Compound Name | N-[4-[1-[(5-chlorothiophen-2-yl)methylamino]ethyl]phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 47030478 |
| Molecular Formula | C16H20Cl2N2OS |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[4-[1-[(5-chlorothiophen-2-yl)methylamino]ethyl]phenyl]propanamide;hydrochloride |
| SMILES | CCC(=O)Nc1ccc(C(C)NCc2ccc(Cl)s2)cc1.Cl |
| InChI | InChI=1S/C16H19ClN2OS.ClH/c1-3-16(20)19-13-6-4-12(5-7-13)11(2)18-10-14-8-9-15(17)21-14;/h4-9,11,18H,3,10H2,1-2H3,(H,19,20);1H |
| InChIKey | XHPKTPPRSZKPCH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |