C20H18N4O2S — CID 142506381
7-[3-[2-(methylamino)ethoxy]phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 142506381) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 7-[3-[2-(methylamino)ethoxy]phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[3-[2-(methylamino)ethoxy]phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142506381 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 7-[3-[2-(methylamino)ethoxy]phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CNCCOc1cccc(-c2csc3c(=O)[nH]c(-c4ccccn4)nc23)c1 |
| InChI | InChI=1S/C20H18N4O2S/c1-21-9-10-26-14-6-4-5-13(11-14)15-12-27-18-17(15)23-19(24-20(18)25)16-7-2-3-8-22-16/h2-8,11-12,21H,9-10H2,1H3,(H,23,24,25) |
| InChIKey | QKENHKOEBQQARZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|