C15H24N2O2 — CID 142506558
ethane;1-[3-(3-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 142506558) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;1-[3-(3-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | ethane;1-[3-(3-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142506558 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethane;1-[3-(3-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | CC.COc1cccc(C2CN(C(C)=O)CCN2)c1 |
| InChI | InChI=1S/C13H18N2O2.C2H6/c1-10(16)15-7-6-14-13(9-15)11-4-3-5-12(8-11)17-2;1-2/h3-5,8,13-14H,6-7,9H2,1-2H3;1-2H3 |
| InChIKey | FBCAQVHXTOEENJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |