C22H27N3O3 — CID 167745798
3-[3-(3-methoxyphenyl)piperazine-1-carbonyl]-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridin-2-one (PubChem CID 167745798) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[3-(3-methoxyphenyl)piperazine-1-carbonyl]-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridin-2-one.
| Compound Name | 3-[3-(3-methoxyphenyl)piperazine-1-carbonyl]-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridin-2-one |
|---|---|
| PubChem CID | 167745798 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[3-(3-methoxyphenyl)piperazine-1-carbonyl]-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridin-2-one |
| SMILES | COc1cccc(C2CN(C(=O)c3cc4c([nH]c3=O)CCCCC4)CCN2)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-28-17-8-5-7-15(12-17)20-14-25(11-10-23-20)22(27)18-13-16-6-3-2-4-9-19(16)24-21(18)26/h5,7-8,12-13,20,23H,2-4,6,9-11,14H2,1H3,(H,24,26) |
| InChIKey | JPODBUMSUYRVAF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |