C18H15N5OS — CID 142506735
7-[4-amino-3-(methylamino)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 142506735) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 7-[4-amino-3-(methylamino)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[4-amino-3-(methylamino)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142506735 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 7-[4-amino-3-(methylamino)phenyl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CNc1cc(-c2csc3c(=O)[nH]c(-c4ccccn4)nc23)ccc1N |
| InChI | InChI=1S/C18H15N5OS/c1-20-14-8-10(5-6-12(14)19)11-9-25-16-15(11)22-17(23-18(16)24)13-4-2-3-7-21-13/h2-9,20H,19H2,1H3,(H,22,23,24) |
| InChIKey | HLIHXLDRSVODST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|