C9H10N6O — CID 135609644
4-[amino(methyl)amino]-6-pyridin-2-yl-1H-1,3,5-triazin-2-one (PubChem CID 135609644) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-[amino(methyl)amino]-6-pyridin-2-yl-1H-1,3,5-triazin-2-one.
| Compound Name | 4-[amino(methyl)amino]-6-pyridin-2-yl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135609644 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-[amino(methyl)amino]-6-pyridin-2-yl-1H-1,3,5-triazin-2-one |
| SMILES | CN(N)c1nc(-c2ccccn2)[nH]c(=O)n1 |
| InChI | InChI=1S/C9H10N6O/c1-15(10)8-12-7(13-9(16)14-8)6-4-2-3-5-11-6/h2-5H,10H2,1H3,(H,12,13,14,16) |
| InChIKey | NDVSSKXSBPMKHR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|