C12H5Cl2N3O2 — CID 500949
5,6-dichloro-2-pyridin-2-yl-1H-benzimidazole-4,7-dione (PubChem CID 500949) has the molecular formula C12H5Cl2N3O2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 5,6-dichloro-2-pyridin-2-yl-1H-benzimidazole-4,7-dione.
| Compound Name | 5,6-dichloro-2-pyridin-2-yl-1H-benzimidazole-4,7-dione |
|---|---|
| PubChem CID | 500949 |
| Molecular Formula | C12H5Cl2N3O2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5,6-dichloro-2-pyridin-2-yl-1H-benzimidazole-4,7-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2[nH]c(-c3ccccn3)nc21 |
| InChI | InChI=1S/C12H5Cl2N3O2/c13-6-7(14)11(19)9-8(10(6)18)16-12(17-9)5-3-1-2-4-15-5/h1-4H,(H,16,17) |
| InChIKey | PXCDFHDNVMXKSR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|