About platinum;2-pyridin-2-yl-1H-benzimidazole
platinum;2-pyridin-2-yl-1H-benzimidazole (PubChem CID 174864241) has the molecular formula C12H9N3Pt
and a molecular weight of 390.30 g/mol. Its IUPAC name is platinum;2-pyridin-2-yl-1H-benzimidazole.
Molecular Properties
| Compound Name | platinum;2-pyridin-2-yl-1H-benzimidazole |
| PubChem CID | 174864241 |
| Molecular Formula | C12H9N3Pt |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | platinum;2-pyridin-2-yl-1H-benzimidazole |
| SMILES | [Pt].c1ccc(-c2nc3ccccc3[nH]2)nc1 |
| InChI | InChI=1S/C12H9N3.Pt/c1-2-6-10-9(5-1)14-12(15-10)11-7-3-4-8-13-11;/h1-8H,(H,14,15); |
| InChIKey | HFTSJMIMPRDFQW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze platinum;2-pyridin-2-yl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;2-pyridin-2-yl-1H-benzimidazole?
The IUPAC name of platinum;2-pyridin-2-yl-1H-benzimidazole (CID 174864241) is platinum;2-pyridin-2-yl-1H-benzimidazole.
What is the SMILES notation for platinum;2-pyridin-2-yl-1H-benzimidazole?
The canonical SMILES for platinum;2-pyridin-2-yl-1H-benzimidazole is [Pt].c1ccc(-c2nc3ccccc3[nH]2)nc1.
What is the InChIKey of platinum;2-pyridin-2-yl-1H-benzimidazole?
The InChIKey is HFTSJMIMPRDFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3.Pt/c1-2-6-10-9(5-1)14-12(15-10)11-7-3-4-8-13-11;/h1-8H,(H,14,15);.
What are the key properties of platinum;2-pyridin-2-yl-1H-benzimidazole?
platinum;2-pyridin-2-yl-1H-benzimidazole has a molecular weight of 390.30 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;2-pyridin-2-yl-1H-benzimidazole is sourced from PubChem (CID 174864241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).