C15H15N5 — CID 123441695
N,N'-dimethyl-2-pyridin-2-yl-3H-benzimidazole-5-carboximidamide (PubChem CID 123441695) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is N,N'-dimethyl-2-pyridin-2-yl-3H-benzimidazole-5-carboximidamide.
| Compound Name | N,N'-dimethyl-2-pyridin-2-yl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 123441695 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N,N'-dimethyl-2-pyridin-2-yl-3H-benzimidazole-5-carboximidamide |
| SMILES | C/N=C(\NC)c1ccc2nc(-c3ccccn3)[nH]c2c1 |
| InChI | InChI=1S/C15H15N5/c1-16-14(17-2)10-6-7-11-13(9-10)20-15(19-11)12-5-3-4-8-18-12/h3-9H,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | GKFYVBYGXFUXIP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|