About copper;palladium;2-pyridin-2-yl-1H-benzimidazole
copper;palladium;2-pyridin-2-yl-1H-benzimidazole (PubChem CID 174748574) has the molecular formula C12H9CuN3Pd
and a molecular weight of 365.19 g/mol. Its IUPAC name is copper;palladium;2-pyridin-2-yl-1H-benzimidazole.
Molecular Properties
| Compound Name | copper;palladium;2-pyridin-2-yl-1H-benzimidazole |
| PubChem CID | 174748574 |
| Molecular Formula | C12H9CuN3Pd |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | copper;palladium;2-pyridin-2-yl-1H-benzimidazole |
| SMILES | [Cu].[Pd].c1ccc(-c2nc3ccccc3[nH]2)nc1 |
| InChI | InChI=1S/C12H9N3.Cu.Pd/c1-2-6-10-9(5-1)14-12(15-10)11-7-3-4-8-13-11;;/h1-8H,(H,14,15);; |
| InChIKey | VFILJFNKLOBRSK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;palladium;2-pyridin-2-yl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;palladium;2-pyridin-2-yl-1H-benzimidazole?
The IUPAC name of copper;palladium;2-pyridin-2-yl-1H-benzimidazole (CID 174748574) is copper;palladium;2-pyridin-2-yl-1H-benzimidazole.
What is the SMILES notation for copper;palladium;2-pyridin-2-yl-1H-benzimidazole?
The canonical SMILES for copper;palladium;2-pyridin-2-yl-1H-benzimidazole is [Cu].[Pd].c1ccc(-c2nc3ccccc3[nH]2)nc1.
What is the InChIKey of copper;palladium;2-pyridin-2-yl-1H-benzimidazole?
The InChIKey is VFILJFNKLOBRSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3.Cu.Pd/c1-2-6-10-9(5-1)14-12(15-10)11-7-3-4-8-13-11;;/h1-8H,(H,14,15);;.
What are the key properties of copper;palladium;2-pyridin-2-yl-1H-benzimidazole?
copper;palladium;2-pyridin-2-yl-1H-benzimidazole has a molecular weight of 365.19 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;palladium;2-pyridin-2-yl-1H-benzimidazole is sourced from PubChem (CID 174748574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).