C60H43N3 — CID 162716933
2-[4,5-bis[4-(1,2,2-triphenylethenyl)phenyl]-1H-imidazol-2-yl]pyridine (PubChem CID 162716933) has the molecular formula C60H43N3 and a molecular weight of 806.03 g/mol. Its IUPAC name is 2-[4,5-bis[4-(1,2,2-triphenylethenyl)phenyl]-1H-imidazol-2-yl]pyridine.
| Compound Name | 2-[4,5-bis[4-(1,2,2-triphenylethenyl)phenyl]-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 162716933 |
| Molecular Formula | C60H43N3 |
| Molecular Weight | 806.03 g/mol |
| Exact Mass | 805.35 |
| IUPAC Name | 2-[4,5-bis[4-(1,2,2-triphenylethenyl)phenyl]-1H-imidazol-2-yl]pyridine |
| SMILES | c1ccc(C(=C(c2ccccc2)c2ccc(-c3nc(-c4ccccn4)[nH]c3-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C60H43N3/c1-7-21-43(22-8-1)54(44-23-9-2-10-24-44)56(47-29-15-5-16-30-47)49-34-38-51(39-35-49)58-59(63-60(62-58)53-33-19-20-42-61-53)52-40-36-50(37-41-52)57(48-31-17-6-18-32-48)55(45-25-11-3-12-26-45)46-27-13-4-14-28-46/h1-42H,(H,62,63) |
| InChIKey | ILLPASPDMUNWFY-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.03 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|