C25H32N4 — CID 142511250
(2E)-1-(4-cyclobutylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine (PubChem CID 142511250) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is (2E)-1-(4-cyclobutylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-1-(4-cyclobutylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511250 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (2E)-1-(4-cyclobutylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(C3CCNCC3)C=CC2=N1 |
| InChI | InChI=1S/C25H32N4/c1-17(2)18(3)14-22(26-4)23-15-24(20-6-5-7-20)29-16-21(8-9-25(29)28-23)19-10-12-27-13-11-19/h8-9,14-16,19,27H,1,5-7,10-13H2,2-4H3/b18-14+,26-22+ |
| InChIKey | VHPYHPWJRSWKJF-YKHOTUSVSA-N |
| XLogP | 5.07 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|