C25H35N5 — CID 91067657
N-[(1Z)-1-(6-ethenylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-6-[(1-methylpiperidin-4-yl)methyl]-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine (PubChem CID 91067657) has the molecular formula C25H35N5 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(1Z)-1-(6-ethenylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-6-[(1-methylpiperidin-4-yl)methyl]-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(1Z)-1-(6-ethenylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-6-[(1-methylpiperidin-4-yl)methyl]-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91067657 |
| Molecular Formula | C25H35N5 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N-[(1Z)-1-(6-ethenylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-6-[(1-methylpiperidin-4-yl)methyl]-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=CC1C=CC=C/C1=C/C(=CC)NC1=NCN=C2CN(CC3CCN(C)CC3)CC21 |
| InChI | InChI=1S/C25H35N5/c1-4-20-8-6-7-9-21(20)14-22(5-2)28-25-23-16-30(17-24(23)26-18-27-25)15-19-10-12-29(3)13-11-19/h4-9,14,19-20,23H,1,10-13,15-18H2,2-3H3,(H,27,28)/b21-14-,22-5? |
| InChIKey | MYAMVPNKNLNGHL-BPXPZWJHSA-N |
| XLogP | 3.42 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|