C21H23F3N4 — CID 91610986
N-[(4aZ)-10-methyl-8,9-dihydrobenzo[8]annulen-6-yl]-6-(2,2,2-trifluoroethyl)-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine (PubChem CID 91610986) has the molecular formula C21H23F3N4 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-[(4aZ)-10-methyl-8,9-dihydrobenzo[8]annulen-6-yl]-6-(2,2,2-trifluoroethyl)-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(4aZ)-10-methyl-8,9-dihydrobenzo[8]annulen-6-yl]-6-(2,2,2-trifluoroethyl)-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91610986 |
| Molecular Formula | C21H23F3N4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[(4aZ)-10-methyl-8,9-dihydrobenzo[8]annulen-6-yl]-6-(2,2,2-trifluoroethyl)-2,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC1=c2cccc/c2=C/C(NC2=NCN=C3CN(CC(F)(F)F)CC32)=CCC1 |
| InChI | InChI=1S/C21H23F3N4/c1-14-5-4-7-16(9-15-6-2-3-8-17(14)15)27-20-18-10-28(12-21(22,23)24)11-19(18)25-13-26-20/h2-3,6-9,18H,4-5,10-13H2,1H3,(H,26,27)/b15-9-,16-7?,17-14? |
| InChIKey | XMSBNLKCXIXEPB-PBBRLLEDSA-N |
| XLogP | 2.21 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |