C16H21N5 — CID 177040302
1-(3,4-diiminocyclohexa-1,5-dien-1-yl)-N-ethyl-N-methyl-2,3,5,6-tetrahydropyrrolo[2,3-b]pyridin-4-amine (PubChem CID 177040302) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)-N-ethyl-N-methyl-2,3,5,6-tetrahydropyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)-N-ethyl-N-methyl-2,3,5,6-tetrahydropyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 177040302 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)-N-ethyl-N-methyl-2,3,5,6-tetrahydropyrrolo[2,3-b]pyridin-4-amine |
| SMILES | [H]/N=C1/C=C(N2CCC3=C(N(C)CC)CCN=C32)C=C/C1=N\[H] |
| InChI | InChI=1S/C16H21N5/c1-3-20(2)15-6-8-19-16-12(15)7-9-21(16)11-4-5-13(17)14(18)10-11/h4-5,10,17-18H,3,6-9H2,1-2H3/b17-13+,18-14- |
| InChIKey | QITBEKAJGWDQIO-XINBEAJESA-N |
| XLogP | 2.19 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|