C33H50N4 — CID 142511208
(Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-(9-methyl-4-methylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)penta-2,4-dien-1-imine (PubChem CID 142511208) has the molecular formula C33H50N4 and a molecular weight of 502.79 g/mol. Its IUPAC name is (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-(9-methyl-4-methylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)penta-2,4-dien-1-imine.
| Compound Name | (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-(9-methyl-4-methylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511208 |
| Molecular Formula | C33H50N4 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-(9-methyl-4-methylidene-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)penta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C)N2C=C(C3CCNCC3)C=C(C)C2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C23H30N4.C10H20/c1-15(2)16(3)12-21(24-6)22-13-18(5)27-14-20(11-17(4)23(27)26-22)19-7-9-25-10-8-19;1-5-7-8-10(4)9(3)6-2/h11-14,19,25H,1,5,7-10H2,2-4,6H3;8-9H,5-7H2,1-4H3/b16-12+,24-21+;10-8- |
| InChIKey | KJRWYWUPACHVOT-XXDCHENFSA-N |
| XLogP | 8.31 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|