C35H55N5O — CID 142511371
(Z)-3,4-dimethyloct-4-ene;2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-7-[(3R)-3-methyl-4-propylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511371) has the molecular formula C35H55N5O and a molecular weight of 561.86 g/mol. Its IUPAC name is (Z)-3,4-dimethyloct-4-ene;2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-7-[(3R)-3-methyl-4-propylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (Z)-3,4-dimethyloct-4-ene;2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-7-[(3R)-3-methyl-4-propylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511371 |
| Molecular Formula | C35H55N5O |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 561.44 |
| IUPAC Name | (Z)-3,4-dimethyloct-4-ene;2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-7-[(3R)-3-methyl-4-propylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)c1cc(=O)n2cc(N3CCN(CCC)[C@H](C)C3)ccc2n1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C25H35N5O.C10H20/c1-7-11-28-12-13-29(16-20(28)5)21-9-10-24-27-23(15-25(31)30(24)17-21)22(26-6)14-19(4)18(3)8-2;1-5-7-8-10(4)9(3)6-2/h9-10,14-15,17,20H,3,7-8,11-13,16H2,1-2,4-6H3;8-9H,5-7H2,1-4H3/b19-14+,26-22+;10-8-/t20-;/m1./s1 |
| InChIKey | IBQIRMDXCOQURZ-ATUNATITSA-N |
| XLogP | 7.73 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|