C24H31N5O — CID 142511402
2-[(2Z,7Z,9Z)-8,11-dimethyl-1-azacycloundeca-2,7,9-trien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511402) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[(2Z,7Z,9Z)-8,11-dimethyl-1-azacycloundeca-2,7,9-trien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(2Z,7Z,9Z)-8,11-dimethyl-1-azacycloundeca-2,7,9-trien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511402 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-[(2Z,7Z,9Z)-8,11-dimethyl-1-azacycloundeca-2,7,9-trien-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1=C/CCC/C=C(/c2cc(=O)n3cc(N4CCNCC4)ccc3n2)NC(C)/C=C\1 |
| InChI | InChI=1S/C24H31N5O/c1-18-6-4-3-5-7-21(26-19(2)9-8-18)22-16-24(30)29-17-20(10-11-23(29)27-22)28-14-12-25-13-15-28/h6-11,16-17,19,25-26H,3-5,12-15H2,1-2H3/b9-8-,18-6-,21-7- |
| InChIKey | HWVCSGZDOIUPCH-WSBZJFRWSA-N |
| XLogP | 3.11 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |