C16H19N5O — CID 142511099
2-[(Z)-1-iminobut-2-en-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 142511099) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[(Z)-1-iminobut-2-en-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(Z)-1-iminobut-2-en-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142511099 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[(Z)-1-iminobut-2-en-2-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | [H]/N=C/C(=C\C)c1cc(=O)n2cc(N3CCNCC3)ccc2n1 |
| InChI | InChI=1S/C16H19N5O/c1-2-12(10-17)14-9-16(22)21-11-13(3-4-15(21)19-14)20-7-5-18-6-8-20/h2-4,9-11,17-18H,5-8H2,1H3/b12-2+,17-10+ |
| InChIKey | RPLVWKXECHZFBV-MQZORURESA-N |
| XLogP | 1.16 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|