C22H18B6ClN5O2 — CID 142511620
CID 142511620 (PubChem CID 142511620) has the molecular formula C22H18B6ClN5O2 and a molecular weight of 484.74 g/mol.
| Compound Name | CID 142511620 |
|---|---|
| PubChem CID | 142511620 |
| Molecular Formula | C22H18B6ClN5O2 |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])(N1CCC(n2c(=O)[nH]c3cc(Cl)ccc32)CC1)C([B])([B])C([B])([B])n1c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C22H18B6ClN5O2/c23-20(24,22(27,28)34-17-4-2-1-3-14(17)30-19(34)36)21(25,26)32-9-7-13(8-10-32)33-16-6-5-12(29)11-15(16)31-18(33)35/h1-6,11,13H,7-10H2,(H,30,36)(H,31,35) |
| InChIKey | BUASWFOYBJXBNC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|