C22H35N3OS — CID 142513193
ethane;1-(1-ethylpiperidin-4-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142513193) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is ethane;1-(1-ethylpiperidin-4-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | ethane;1-(1-ethylpiperidin-4-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142513193 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | ethane;1-(1-ethylpiperidin-4-yl)sulfanyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC.CCN1CCC(SNC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1 |
| InChI | InChI=1S/C20H29N3OS.C2H6/c1-2-23-11-9-16(10-12-23)25-22-20(24)21-19-17-7-3-5-14(17)13-15-6-4-8-18(15)19;1-2/h13,16H,2-12H2,1H3,(H2,21,22,24);1-2H3 |
| InChIKey | LOUNJKLZCJKGRQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|