C15H34N2 — CID 142516288
ethane;2-methyl-1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine (PubChem CID 142516288) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is ethane;2-methyl-1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine.
| Compound Name | ethane;2-methyl-1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine |
|---|---|
| PubChem CID | 142516288 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | ethane;2-methyl-1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine |
| SMILES | C=C/C(=C/C)N(/C=C\C)NC.CC.CC.CC |
| InChI | InChI=1S/C9H16N2.3C2H6/c1-5-8-11(10-4)9(6-2)7-3;3*1-2/h5-8,10H,2H2,1,3-4H3;3*1-2H3/b8-5-,9-7-;;; |
| InChIKey | DYVARDZPFATHFK-OJKZZKQASA-N |
| XLogP | 5.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|