C15H31NO — CID 142516507
pentane;3,3,6,6-tetramethylazepan-2-one (PubChem CID 142516507) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is pentane;3,3,6,6-tetramethylazepan-2-one.
| Compound Name | pentane;3,3,6,6-tetramethylazepan-2-one |
|---|---|
| PubChem CID | 142516507 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | pentane;3,3,6,6-tetramethylazepan-2-one |
| SMILES | CC1(C)CCC(C)(C)C(=O)NC1.CCCCC |
| InChI | InChI=1S/C10H19NO.C5H12/c1-9(2)5-6-10(3,4)8(12)11-7-9;1-3-5-4-2/h5-7H2,1-4H3,(H,11,12);3-5H2,1-2H3 |
| InChIKey | KFQNCPHQLUUQKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |