C9H19NO2 — CID 143321843
5,5-dimethyl-1,3-oxazepan-2-one;ethane (PubChem CID 143321843) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-oxazepan-2-one;ethane.
| Compound Name | 5,5-dimethyl-1,3-oxazepan-2-one;ethane |
|---|---|
| PubChem CID | 143321843 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 5,5-dimethyl-1,3-oxazepan-2-one;ethane |
| SMILES | CC.CC1(C)CCOC(=O)NC1 |
| InChI | InChI=1S/C7H13NO2.C2H6/c1-7(2)3-4-10-6(9)8-5-7;1-2/h3-5H2,1-2H3,(H,8,9);1-2H3 |
| InChIKey | KXZVWDISXXWVHC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |