C9H21NO3 — CID 177227287
ethane;2-methoxypropane;1,3-oxazolidin-2-one (PubChem CID 177227287) has the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. Its IUPAC name is ethane;2-methoxypropane;1,3-oxazolidin-2-one.
| Compound Name | ethane;2-methoxypropane;1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 177227287 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | ethane;2-methoxypropane;1,3-oxazolidin-2-one |
| SMILES | CC.COC(C)C.O=C1NCCO1 |
| InChI | InChI=1S/C4H10O.C3H5NO2.C2H6/c1-4(2)5-3;5-3-4-1-2-6-3;1-2/h4H,1-3H3;1-2H2,(H,4,5);1-2H3 |
| InChIKey | KRFFUPMVXOPLBX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |