C21H10B2BrF7N2O5 — CID 142516998
CID 142516998 (PubChem CID 142516998) has the molecular formula C21H10B2BrF7N2O5 and a molecular weight of 604.83 g/mol.
| Compound Name | CID 142516998 |
|---|---|
| PubChem CID | 142516998 |
| Molecular Formula | C21H10B2BrF7N2O5 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 603.98 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)Oc1cc(OC(F)(F)F)ccc1Oc1ccc(C(F)(F)F)c(F)c1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C21H10B2BrF7N2O5/c22-20(23,35)38-13-8-9(37-21(29,30)31)4-6-11(13)36-12-7-5-10(19(26,27)28)17(25)16(12)18(34)33-15-3-1-2-14(24)32-15/h1-8,35H,(H,32,33,34) |
| InChIKey | ZOOFVORBGRYTCJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|