C33H47N7O6 — CID 142517970
ethane;[5-hydroxy-4-[5-(morpholin-4-ylmethyl)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 5-amino-1-[amino(methyl)carbamoyl]imidazole-4-carboxylate (PubChem CID 142517970) has the molecular formula C33H47N7O6 and a molecular weight of 637.78 g/mol. Its IUPAC name is ethane;[5-hydroxy-4-[5-(morpholin-4-ylmethyl)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 5-amino-1-[amino(methyl)carbamoyl]imidazole-4-carboxylate.
| Compound Name | ethane;[5-hydroxy-4-[5-(morpholin-4-ylmethyl)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 5-amino-1-[amino(methyl)carbamoyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 142517970 |
| Molecular Formula | C33H47N7O6 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | ethane;[5-hydroxy-4-[5-(morpholin-4-ylmethyl)-1,3-dihydroisoindole-2-carbonyl]-2-propan-2-ylphenyl] 5-amino-1-[amino(methyl)carbamoyl]imidazole-4-carboxylate |
| SMILES | CC.CC.CC(C)c1cc(C(=O)N2Cc3ccc(CN4CCOCC4)cc3C2)c(O)cc1OC(=O)c1ncn(C(=O)N(C)N)c1N |
| InChI | InChI=1S/C29H35N7O6.2C2H6/c1-17(2)21-11-22(23(37)12-24(21)42-28(39)25-26(30)36(16-32-25)29(40)33(3)31)27(38)35-14-19-5-4-18(10-20(19)15-35)13-34-6-8-41-9-7-34;2*1-2/h4-5,10-12,16-17,37H,6-9,13-15,30-31H2,1-3H3;2*1-2H3 |
| InChIKey | LXDZQIJVUJYWGV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 169.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|