C26H46O2 — CID 142518824
(2Z,7E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-4-yne-1,6-diol;ethane;2-methylpropane (PubChem CID 142518824) has the molecular formula C26H46O2 and a molecular weight of 390.65 g/mol. Its IUPAC name is (2Z,7E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-4-yne-1,6-diol;ethane;2-methylpropane.
| Compound Name | (2Z,7E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-4-yne-1,6-diol;ethane;2-methylpropane |
|---|---|
| PubChem CID | 142518824 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | (2Z,7E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-4-yne-1,6-diol;ethane;2-methylpropane |
| SMILES | CC.CC(C)C.CC1=C(C/C=C(\C)C(O)C#C/C(C)=C\CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H30O2.C4H10.C2H6/c1-15(12-14-21)8-11-19(22)17(3)9-10-18-16(2)7-6-13-20(18,4)5;1-4(2)3;1-2/h9,12,19,21-22H,6-7,10,13-14H2,1-5H3;4H,1-3H3;1-2H3/b15-12-,17-9+;; |
| InChIKey | CSWXNHDEWLLGJE-BVLGOMQBSA-N |
| XLogP | 6.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|