C21H32N4 — CID 142520311
4-(3,4-dimethylpyrrolidin-1-yl)-2,3-bis(methylideneamino)benzonitrile;propane;prop-1-ene (PubChem CID 142520311) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-bis(methylideneamino)benzonitrile;propane;prop-1-ene.
| Compound Name | 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-bis(methylideneamino)benzonitrile;propane;prop-1-ene |
|---|---|
| PubChem CID | 142520311 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-bis(methylideneamino)benzonitrile;propane;prop-1-ene |
| SMILES | C=CC.C=Nc1c(C#N)ccc(N2CC(C)C(C)C2)c1N=C.CCC |
| InChI | InChI=1S/C15H18N4.C3H8.C3H6/c1-10-8-19(9-11(10)2)13-6-5-12(7-16)14(17-3)15(13)18-4;2*1-3-2/h5-6,10-11H,3-4,8-9H2,1-2H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | GEJCWQWQZKSZID-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|