C13H14F2N2 — CID 107933955
4-(3,4-dimethylpyrrolidin-1-yl)-2,3-difluorobenzonitrile (PubChem CID 107933955) has the molecular formula C13H14F2N2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-difluorobenzonitrile.
| Compound Name | 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933955 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-(3,4-dimethylpyrrolidin-1-yl)-2,3-difluorobenzonitrile |
| SMILES | CC1CN(c2ccc(C#N)c(F)c2F)CC1C |
| InChI | InChI=1S/C13H14F2N2/c1-8-6-17(7-9(8)2)11-4-3-10(5-16)12(14)13(11)15/h3-4,8-9H,6-7H2,1-2H3 |
| InChIKey | IZQWGAQGDBWNQX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |