C16H18F2N2 — CID 107933790
4-(8-azaspiro[4.5]decan-8-yl)-2,3-difluorobenzonitrile (PubChem CID 107933790) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-(8-azaspiro[4.5]decan-8-yl)-2,3-difluorobenzonitrile.
| Compound Name | 4-(8-azaspiro[4.5]decan-8-yl)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933790 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(8-azaspiro[4.5]decan-8-yl)-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCC3(CCCC3)CC2)c(F)c1F |
| InChI | InChI=1S/C16H18F2N2/c17-14-12(11-19)3-4-13(15(14)18)20-9-7-16(8-10-20)5-1-2-6-16/h3-4H,1-2,5-10H2 |
| InChIKey | KPOZFKSOEPEYGF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |