C15H19F2N3 — CID 107933463
4-(4-tert-butylpiperazin-1-yl)-2,3-difluorobenzonitrile (PubChem CID 107933463) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is 4-(4-tert-butylpiperazin-1-yl)-2,3-difluorobenzonitrile.
| Compound Name | 4-(4-tert-butylpiperazin-1-yl)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933463 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-(4-tert-butylpiperazin-1-yl)-2,3-difluorobenzonitrile |
| SMILES | CC(C)(C)N1CCN(c2ccc(C#N)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H19F2N3/c1-15(2,3)20-8-6-19(7-9-20)12-5-4-11(10-18)13(16)14(12)17/h4-5H,6-9H2,1-3H3 |
| InChIKey | OZYPXTYMPNRGNC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |