C22H29FN4O — CID 142520357
2-(4-fluoropiperidin-4-yl)-N-[4-methyl-1-(8-methylquinolin-5-yl)pyrrolidin-3-yl]acetamide (PubChem CID 142520357) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-(4-fluoropiperidin-4-yl)-N-[4-methyl-1-(8-methylquinolin-5-yl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(4-fluoropiperidin-4-yl)-N-[4-methyl-1-(8-methylquinolin-5-yl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 142520357 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-(4-fluoropiperidin-4-yl)-N-[4-methyl-1-(8-methylquinolin-5-yl)pyrrolidin-3-yl]acetamide |
| SMILES | Cc1ccc(N2CC(C)C(NC(=O)CC3(F)CCNCC3)C2)c2cccnc12 |
| InChI | InChI=1S/C22H29FN4O/c1-15-5-6-19(17-4-3-9-25-21(15)17)27-13-16(2)18(14-27)26-20(28)12-22(23)7-10-24-11-8-22/h3-6,9,16,18,24H,7-8,10-14H2,1-2H3,(H,26,28) |
| InChIKey | DNGJYRGGNWZRRV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |