C19H28N2O4 — CID 142520951
3,4-dimethyl-N-(2-oxoethyl)benzamide;methyl 1-methylpiperidine-4-carboxylate (PubChem CID 142520951) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-oxoethyl)benzamide;methyl 1-methylpiperidine-4-carboxylate.
| Compound Name | 3,4-dimethyl-N-(2-oxoethyl)benzamide;methyl 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 142520951 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3,4-dimethyl-N-(2-oxoethyl)benzamide;methyl 1-methylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C)CC1.Cc1ccc(C(=O)NCC=O)cc1C |
| InChI | InChI=1S/C11H13NO2.C8H15NO2/c1-8-3-4-10(7-9(8)2)11(14)12-5-6-13;1-9-5-3-7(4-6-9)8(10)11-2/h3-4,6-7H,5H2,1-2H3,(H,12,14);7H,3-6H2,1-2H3 |
| InChIKey | DJWOMGLAUSDJQH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|